C23H28O7 — CID 118443194
[2-hydroxy-3-[4-[[4-(2-hydroxy-3-methoxypropoxy)phenyl]methyl]phenoxy]propyl] prop-2-enoate (PubChem CID 118443194) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[[4-(2-hydroxy-3-methoxypropoxy)phenyl]methyl]phenoxy]propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-[4-[[4-(2-hydroxy-3-methoxypropoxy)phenyl]methyl]phenoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 118443194 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [2-hydroxy-3-[4-[[4-(2-hydroxy-3-methoxypropoxy)phenyl]methyl]phenoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccc(Cc2ccc(OCC(O)COC)cc2)cc1 |
| InChI | InChI=1S/C23H28O7/c1-3-23(26)30-16-20(25)15-29-22-10-6-18(7-11-22)12-17-4-8-21(9-5-17)28-14-19(24)13-27-2/h3-11,19-20,24-25H,1,12-16H2,2H3 |
| InChIKey | BWMYEUNRASBCJC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|