C20H22O4 — CID 142355257
[1-(4-benzylphenoxy)-3-methoxypropan-2-yl] prop-2-enoate (PubChem CID 142355257) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is [1-(4-benzylphenoxy)-3-methoxypropan-2-yl] prop-2-enoate.
| Compound Name | [1-(4-benzylphenoxy)-3-methoxypropan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 142355257 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [1-(4-benzylphenoxy)-3-methoxypropan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(COC)COc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O4/c1-3-20(21)24-19(14-22-2)15-23-18-11-9-17(10-12-18)13-16-7-5-4-6-8-16/h3-12,19H,1,13-15H2,2H3 |
| InChIKey | SZFGRGUKHUBDCP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|