C14H16O5 — CID 145121720
[1-(4-formylphenoxy)-3-methoxypropan-2-yl] prop-2-enoate (PubChem CID 145121720) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is [1-(4-formylphenoxy)-3-methoxypropan-2-yl] prop-2-enoate.
| Compound Name | [1-(4-formylphenoxy)-3-methoxypropan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 145121720 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [1-(4-formylphenoxy)-3-methoxypropan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(COC)COc1ccc(C=O)cc1 |
| InChI | InChI=1S/C14H16O5/c1-3-14(16)19-13(9-17-2)10-18-12-6-4-11(8-15)5-7-12/h3-8,13H,1,9-10H2,2H3 |
| InChIKey | NQMYZURUNSHXIQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|