C36H34O10S2 — CID 59739137
[3-[4-[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenyl]sulfanylphenoxy]-2-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 59739137) has the molecular formula C36H34O10S2 and a molecular weight of 690.79 g/mol. Its IUPAC name is [3-[4-[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenyl]sulfanylphenoxy]-2-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [3-[4-[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenyl]sulfanylphenoxy]-2-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 59739137 |
| Molecular Formula | C36H34O10S2 |
| Molecular Weight | 690.79 g/mol |
| Exact Mass | 690.16 |
| IUPAC Name | [3-[4-[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenyl]sulfanylphenoxy]-2-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc(Sc2ccc(Sc3ccc(OCC(COC(=O)C=C)OC(=O)C=C)cc3)cc2)cc1)OC(=O)C=C |
| InChI | InChI=1S/C36H34O10S2/c1-5-33(37)43-23-27(45-35(39)7-3)21-41-25-9-13-29(14-10-25)47-31-17-19-32(20-18-31)48-30-15-11-26(12-16-30)42-22-28(46-36(40)8-4)24-44-34(38)6-2/h5-20,27-28H,1-4,21-24H2 |
| InChIKey | YMMDSCLSRMNYOD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.79 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|