C30H30O10S — CID 126666525
[3-[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenyl]peroxycarbonyl-2-methylbut-3-enyl] prop-2-enoate (PubChem CID 126666525) has the molecular formula C30H30O10S and a molecular weight of 582.63 g/mol. Its IUPAC name is [3-[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenyl]peroxycarbonyl-2-methylbut-3-enyl] prop-2-enoate.
| Compound Name | [3-[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenyl]peroxycarbonyl-2-methylbut-3-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 126666525 |
| Molecular Formula | C30H30O10S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | [3-[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenyl]peroxycarbonyl-2-methylbut-3-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc(Sc2ccc(OOC(=O)C(=C)C(C)COC(=O)C=C)cc2)cc1)OC(=O)C=C |
| InChI | InChI=1S/C30H30O10S/c1-6-27(31)36-17-20(4)21(5)30(34)40-39-23-11-15-26(16-12-23)41-25-13-9-22(10-14-25)35-18-24(38-29(33)8-3)19-37-28(32)7-2/h6-16,20,24H,1-3,5,17-19H2,4H3 |
| InChIKey | MSCZSMHOEBEFQL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|