C30H30O10S — CID 126666524
4-[[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenoxy]methyl]-5-prop-2-enoyloxypent-2-enoic acid (PubChem CID 126666524) has the molecular formula C30H30O10S and a molecular weight of 582.63 g/mol. Its IUPAC name is 4-[[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenoxy]methyl]-5-prop-2-enoyloxypent-2-enoic acid.
| Compound Name | 4-[[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenoxy]methyl]-5-prop-2-enoyloxypent-2-enoic acid |
|---|---|
| PubChem CID | 126666524 |
| Molecular Formula | C30H30O10S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 4-[[4-[4-[2,3-di(prop-2-enoyloxy)propoxy]phenyl]sulfanylphenoxy]methyl]-5-prop-2-enoyloxypent-2-enoic acid |
| SMILES | C=CC(=O)OCC(C=CC(=O)O)COc1ccc(Sc2ccc(OCC(COC(=O)C=C)OC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C30H30O10S/c1-4-28(33)38-18-21(7-16-27(31)32)17-36-22-8-12-25(13-9-22)41-26-14-10-23(11-15-26)37-19-24(40-30(35)6-3)20-39-29(34)5-2/h4-16,21,24H,1-3,17-20H2,(H,31,32) |
| InChIKey | WUEJLXOGUJZWIA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|