C18H17ClO3S — CID 58961721
[1-(4-chlorophenoxy)-3-phenylsulfanylpropan-2-yl] prop-2-enoate (PubChem CID 58961721) has the molecular formula C18H17ClO3S and a molecular weight of 348.85 g/mol. Its IUPAC name is [1-(4-chlorophenoxy)-3-phenylsulfanylpropan-2-yl] prop-2-enoate.
| Compound Name | [1-(4-chlorophenoxy)-3-phenylsulfanylpropan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 58961721 |
| Molecular Formula | C18H17ClO3S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [1-(4-chlorophenoxy)-3-phenylsulfanylpropan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(COc1ccc(Cl)cc1)CSc1ccccc1 |
| InChI | InChI=1S/C18H17ClO3S/c1-2-18(20)22-16(13-23-17-6-4-3-5-7-17)12-21-15-10-8-14(19)9-11-15/h2-11,16H,1,12-13H2 |
| InChIKey | FLAXZCSAJHEAOB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|