About 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate
1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate (PubChem CID 175225136) has the molecular formula C20H24O4
and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate.
Molecular Properties
| Compound Name | 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate |
| PubChem CID | 175225136 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CO.COc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.C6H10O3/c1-15-14-9-7-13(8-10-14)11-12-5-3-2-4-6-12;1-3-6(8)9-5(2)4-7/h2-10H,11H2,1H3;3,5,7H,1,4H2,2H3 |
| InChIKey | ZSNQSNIQNVRCDO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate?
The IUPAC name of 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate (CID 175225136) is 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate.
What is the SMILES notation for 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate?
The canonical SMILES for 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate is C=CC(=O)OC(C)CO.COc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate?
The InChIKey is ZSNQSNIQNVRCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C6H10O3/c1-15-14-9-7-13(8-10-14)11-12-5-3-2-4-6-12;1-3-6(8)9-5(2)4-7/h2-10H,11H2,1H3;3,5,7H,1,4H2,2H3.
What are the key properties of 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate?
1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate has a molecular weight of 328.41 g/mol, XLogP of 3.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-methoxybenzene;1-hydroxypropan-2-yl prop-2-enoate is sourced from PubChem (CID 175225136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).