About 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron
1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron (PubChem CID 158050824) has the molecular formula C14H15F6OSb
and a molecular weight of 435.02 g/mol. Its IUPAC name is 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron.
Molecular Properties
| Compound Name | 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron |
| PubChem CID | 158050824 |
| Molecular Formula | C14H15F6OSb |
| Molecular Weight | 435.02 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron |
| SMILES | COc1ccc(Cc2ccccc2)cc1.F[Sb-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C14H14O.6FH.Sb/c1-15-14-9-7-13(8-10-14)11-12-5-3-2-4-6-12;;;;;;;/h2-10H,11H2,1H3;6*1H;/q;;;;;;;+5/p-5 |
| InChIKey | FJLOZVXBDJKWAR-UHFFFAOYSA-I |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.02 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron?
The IUPAC name of 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron (CID 158050824) is 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron.
What is the SMILES notation for 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron?
The canonical SMILES for 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron is COc1ccc(Cc2ccccc2)cc1.F[Sb-](F)(F)(F)(F)F.[H+].
What is the InChIKey of 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron?
The InChIKey is FJLOZVXBDJKWAR-UHFFFAOYSA-I. The full InChI is InChI=1S/C14H14O.6FH.Sb/c1-15-14-9-7-13(8-10-14)11-12-5-3-2-4-6-12;;;;;;;/h2-10H,11H2,1H3;6*1H;/q;;;;;;;+5/p-5.
What are the key properties of 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron?
1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron has a molecular weight of 435.02 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-methoxybenzene;hexafluoroantimony(1-);hydron is sourced from PubChem (CID 158050824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).