About methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene
methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene (PubChem CID 90734985) has the molecular formula C27H30O2
and a molecular weight of 386.54 g/mol. Its IUPAC name is methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene.
Molecular Properties
| Compound Name | methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene |
| PubChem CID | 90734985 |
| Molecular Formula | C27H30O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene |
| SMILES | COC.COc1ccc(Cc2ccc(C)cc2)cc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16O.C10H8.C2H6O/c1-12-3-5-13(6-4-12)11-14-7-9-15(16-2)10-8-14;1-2-6-10-8-4-3-7-9(10)5-1;1-3-2/h3-10H,11H2,1-2H3;1-8H;1-2H3 |
| InChIKey | QVNVNTYKJUPNET-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene?
The IUPAC name of methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene (CID 90734985) is methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene.
What is the SMILES notation for methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene?
The canonical SMILES for methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene is COC.COc1ccc(Cc2ccc(C)cc2)cc1.c1ccc2ccccc2c1.
What is the InChIKey of methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene?
The InChIKey is QVNVNTYKJUPNET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O.C10H8.C2H6O/c1-12-3-5-13(6-4-12)11-14-7-9-15(16-2)10-8-14;1-2-6-10-8-4-3-7-9(10)5-1;1-3-2/h3-10H,11H2,1-2H3;1-8H;1-2H3.
What are the key properties of methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene?
methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene has a molecular weight of 386.54 g/mol, XLogP of 6.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;1-methoxy-4-[(4-methylphenyl)methyl]benzene;naphthalene is sourced from PubChem (CID 90734985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).