C18H24O — CID 143200250
ethane;1-[(4-methoxyphenyl)methyl]-2,4-dimethylbenzene (PubChem CID 143200250) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is ethane;1-[(4-methoxyphenyl)methyl]-2,4-dimethylbenzene.
| Compound Name | ethane;1-[(4-methoxyphenyl)methyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 143200250 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | ethane;1-[(4-methoxyphenyl)methyl]-2,4-dimethylbenzene |
| SMILES | CC.COc1ccc(Cc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C16H18O.C2H6/c1-12-4-7-15(13(2)10-12)11-14-5-8-16(17-3)9-6-14;1-2/h4-10H,11H2,1-3H3;1-2H3 |
| InChIKey | JCHSKDLBDQHLTB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |