C38H38O4 — CID 175327763
1,2,3,4-tetrakis[(4-methoxyphenyl)methyl]benzene (PubChem CID 175327763) has the molecular formula C38H38O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is 1,2,3,4-tetrakis[(4-methoxyphenyl)methyl]benzene.
| Compound Name | 1,2,3,4-tetrakis[(4-methoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 175327763 |
| Molecular Formula | C38H38O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 1,2,3,4-tetrakis[(4-methoxyphenyl)methyl]benzene |
| SMILES | COc1ccc(Cc2ccc(Cc3ccc(OC)cc3)c(Cc3ccc(OC)cc3)c2Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H38O4/c1-39-33-15-5-27(6-16-33)23-31-13-14-32(24-28-7-17-34(40-2)18-8-28)38(26-30-11-21-36(42-4)22-12-30)37(31)25-29-9-19-35(41-3)20-10-29/h5-22H,23-26H2,1-4H3 |
| InChIKey | QEQSBWLPCBHENN-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |