About 2-methoxy-6-methylnaphthalene;2-methylnaphthalene
2-methoxy-6-methylnaphthalene;2-methylnaphthalene (PubChem CID 161453855) has the molecular formula C23H22O
and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-methoxy-6-methylnaphthalene;2-methylnaphthalene.
Molecular Properties
| Compound Name | 2-methoxy-6-methylnaphthalene;2-methylnaphthalene |
| PubChem CID | 161453855 |
| Molecular Formula | C23H22O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-methoxy-6-methylnaphthalene;2-methylnaphthalene |
| SMILES | COc1ccc2cc(C)ccc2c1.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H12O.C11H10/c1-9-3-4-11-8-12(13-2)6-5-10(11)7-9;1-9-6-7-10-4-2-3-5-11(10)8-9/h3-8H,1-2H3;2-8H,1H3 |
| InChIKey | WAWRMGCUDVVHGB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methoxy-6-methylnaphthalene;2-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6-methylnaphthalene;2-methylnaphthalene?
The IUPAC name of 2-methoxy-6-methylnaphthalene;2-methylnaphthalene (CID 161453855) is 2-methoxy-6-methylnaphthalene;2-methylnaphthalene.
What is the SMILES notation for 2-methoxy-6-methylnaphthalene;2-methylnaphthalene?
The canonical SMILES for 2-methoxy-6-methylnaphthalene;2-methylnaphthalene is COc1ccc2cc(C)ccc2c1.Cc1ccc2ccccc2c1.
What is the InChIKey of 2-methoxy-6-methylnaphthalene;2-methylnaphthalene?
The InChIKey is WAWRMGCUDVVHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O.C11H10/c1-9-3-4-11-8-12(13-2)6-5-10(11)7-9;1-9-6-7-10-4-2-3-5-11(10)8-9/h3-8H,1-2H3;2-8H,1H3.
What are the key properties of 2-methoxy-6-methylnaphthalene;2-methylnaphthalene?
2-methoxy-6-methylnaphthalene;2-methylnaphthalene has a molecular weight of 314.43 g/mol, XLogP of 6.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6-methylnaphthalene;2-methylnaphthalene is sourced from PubChem (CID 161453855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).