About 2-methylnaphthalene chloride
2-methylnaphthalene chloride (PubChem CID 21193556) has the molecular formula C11H10Cl-
and a molecular weight of 177.65 g/mol. Its IUPAC name is 2-methylnaphthalene chloride.
Molecular Properties
| Compound Name | 2-methylnaphthalene chloride |
| PubChem CID | 21193556 |
| Molecular Formula | C11H10Cl- |
| Molecular Weight | 177.65 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 2-methylnaphthalene chloride |
| SMILES | Cc1ccc2ccccc2c1.[Cl-] |
| InChI | InChI=1S/C11H10.ClH/c1-9-6-7-10-4-2-3-5-11(10)8-9;/h2-8H,1H3;1H/p-1 |
| InChIKey | FKBYMYFASKNDEC-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.65 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylnaphthalene chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnaphthalene chloride?
The IUPAC name of 2-methylnaphthalene chloride (CID 21193556) is 2-methylnaphthalene chloride.
What is the SMILES notation for 2-methylnaphthalene chloride?
The canonical SMILES for 2-methylnaphthalene chloride is Cc1ccc2ccccc2c1.[Cl-].
What is the InChIKey of 2-methylnaphthalene chloride?
The InChIKey is FKBYMYFASKNDEC-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10.ClH/c1-9-6-7-10-4-2-3-5-11(10)8-9;/h2-8H,1H3;1H/p-1.
What are the key properties of 2-methylnaphthalene chloride?
2-methylnaphthalene chloride has a molecular weight of 177.65 g/mol, XLogP of 0.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnaphthalene chloride is sourced from PubChem (CID 21193556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).