2-methylnaphthalene chloride

C11H10Cl- — CID 21193556

IUPAC2-methylnaphthalene chloride
SMILESCc1ccc2ccccc2c1.[Cl-]
InChIInChI=1S/C11H10.ClH/c1-9-6-7-10-4-2-3-5-11(10)8-9;/h2-8H,1H3;1H/p-1
InChIKeyFKBYMYFASKNDEC-UHFFFAOYSA-M
MW177.65 g/mol
LogP0.15
Rot. Bonds

About 2-methylnaphthalene chloride

2-methylnaphthalene chloride (PubChem CID 21193556) has the molecular formula C11H10Cl- and a molecular weight of 177.65 g/mol. Its IUPAC name is 2-methylnaphthalene chloride.

Molecular Properties

Compound Name2-methylnaphthalene chloride
PubChem CID21193556
Molecular FormulaC11H10Cl-
Molecular Weight177.65 g/mol
Exact Mass177.05
IUPAC Name2-methylnaphthalene chloride
SMILESCc1ccc2ccccc2c1.[Cl-]
InChIInChI=1S/C11H10.ClH/c1-9-6-7-10-4-2-3-5-11(10)8-9;/h2-8H,1H3;1H/p-1
InChIKeyFKBYMYFASKNDEC-UHFFFAOYSA-M
XLogP0.15
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.65
LogP ≤ 50.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze 2-methylnaphthalene chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylnaphthalene chloride?
The IUPAC name of 2-methylnaphthalene chloride (CID 21193556) is 2-methylnaphthalene chloride.
What is the SMILES notation for 2-methylnaphthalene chloride?
The canonical SMILES for 2-methylnaphthalene chloride is Cc1ccc2ccccc2c1.[Cl-].
What is the InChIKey of 2-methylnaphthalene chloride?
The InChIKey is FKBYMYFASKNDEC-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10.ClH/c1-9-6-7-10-4-2-3-5-11(10)8-9;/h2-8H,1H3;1H/p-1.
What are the key properties of 2-methylnaphthalene chloride?
2-methylnaphthalene chloride has a molecular weight of 177.65 g/mol, XLogP of 0.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnaphthalene chloride is sourced from PubChem (CID 21193556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).