About benzene;2-methylnaphthalene
benzene;2-methylnaphthalene (PubChem CID 159438891) has the molecular formula C17H16
and a molecular weight of 220.31 g/mol. Its IUPAC name is benzene;2-methylnaphthalene.
Molecular Properties
| Compound Name | benzene;2-methylnaphthalene |
| PubChem CID | 159438891 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | benzene;2-methylnaphthalene |
| SMILES | Cc1ccc2ccccc2c1.c1ccccc1 |
| InChI | InChI=1S/C11H10.C6H6/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-2-4-6-5-3-1/h2-8H,1H3;1-6H |
| InChIKey | LRXQSICOCNFQMS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;2-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-methylnaphthalene?
The IUPAC name of benzene;2-methylnaphthalene (CID 159438891) is benzene;2-methylnaphthalene.
What is the SMILES notation for benzene;2-methylnaphthalene?
The canonical SMILES for benzene;2-methylnaphthalene is Cc1ccc2ccccc2c1.c1ccccc1.
What is the InChIKey of benzene;2-methylnaphthalene?
The InChIKey is LRXQSICOCNFQMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C6H6/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-2-4-6-5-3-1/h2-8H,1H3;1-6H.
What are the key properties of benzene;2-methylnaphthalene?
benzene;2-methylnaphthalene has a molecular weight of 220.31 g/mol, XLogP of 4.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-methylnaphthalene is sourced from PubChem (CID 159438891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).