About 2-methylnaphthalene;dihydrate
2-methylnaphthalene;dihydrate (PubChem CID 174912803) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-methylnaphthalene;dihydrate.
Molecular Properties
| Compound Name | 2-methylnaphthalene;dihydrate |
| PubChem CID | 174912803 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-methylnaphthalene;dihydrate |
| SMILES | Cc1ccc2ccccc2c1.O.O |
| InChI | InChI=1S/C11H10.2H2O/c1-9-6-7-10-4-2-3-5-11(10)8-9;;/h2-8H,1H3;2*1H2 |
| InChIKey | AYXACCOZMSQFMT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylnaphthalene;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnaphthalene;dihydrate?
The IUPAC name of 2-methylnaphthalene;dihydrate (CID 174912803) is 2-methylnaphthalene;dihydrate.
What is the SMILES notation for 2-methylnaphthalene;dihydrate?
The canonical SMILES for 2-methylnaphthalene;dihydrate is Cc1ccc2ccccc2c1.O.O.
What is the InChIKey of 2-methylnaphthalene;dihydrate?
The InChIKey is AYXACCOZMSQFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.2H2O/c1-9-6-7-10-4-2-3-5-11(10)8-9;;/h2-8H,1H3;2*1H2.
What are the key properties of 2-methylnaphthalene;dihydrate?
2-methylnaphthalene;dihydrate has a molecular weight of 178.23 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnaphthalene;dihydrate is sourced from PubChem (CID 174912803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).