About butane;2-methylanthracene
butane;2-methylanthracene (PubChem CID 90696557) has the molecular formula C19H22
and a molecular weight of 250.38 g/mol. Its IUPAC name is butane;2-methylanthracene.
Molecular Properties
| Compound Name | butane;2-methylanthracene |
| PubChem CID | 90696557 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | butane;2-methylanthracene |
| SMILES | CCCC.Cc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C15H12.C4H10/c1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11;1-3-4-2/h2-10H,1H3;3-4H2,1-2H3 |
| InChIKey | LGVKZMVYVLCTDX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze butane;2-methylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-methylanthracene?
The IUPAC name of butane;2-methylanthracene (CID 90696557) is butane;2-methylanthracene.
What is the SMILES notation for butane;2-methylanthracene?
The canonical SMILES for butane;2-methylanthracene is CCCC.Cc1ccc2cc3ccccc3cc2c1.
What is the InChIKey of butane;2-methylanthracene?
The InChIKey is LGVKZMVYVLCTDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C4H10/c1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11;1-3-4-2/h2-10H,1H3;3-4H2,1-2H3.
What are the key properties of butane;2-methylanthracene?
butane;2-methylanthracene has a molecular weight of 250.38 g/mol, XLogP of 6.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-methylanthracene is sourced from PubChem (CID 90696557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).