About anthracene-9,10-dione;2-methylanthracene
anthracene-9,10-dione;2-methylanthracene (PubChem CID 159482173) has the molecular formula C29H20O2
and a molecular weight of 400.48 g/mol. Its IUPAC name is anthracene-9,10-dione;2-methylanthracene.
Molecular Properties
| Compound Name | anthracene-9,10-dione;2-methylanthracene |
| PubChem CID | 159482173 |
| Molecular Formula | C29H20O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | anthracene-9,10-dione;2-methylanthracene |
| SMILES | Cc1ccc2cc3ccccc3cc2c1.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H12.C14H8O2/c1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h2-10H,1H3;1-8H |
| InChIKey | LXDDGYYPIVLPQB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dione;2-methylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dione;2-methylanthracene?
The IUPAC name of anthracene-9,10-dione;2-methylanthracene (CID 159482173) is anthracene-9,10-dione;2-methylanthracene.
What is the SMILES notation for anthracene-9,10-dione;2-methylanthracene?
The canonical SMILES for anthracene-9,10-dione;2-methylanthracene is Cc1ccc2cc3ccccc3cc2c1.O=C1c2ccccc2C(=O)c2ccccc21.
What is the InChIKey of anthracene-9,10-dione;2-methylanthracene?
The InChIKey is LXDDGYYPIVLPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C14H8O2/c1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h2-10H,1H3;1-8H.
What are the key properties of anthracene-9,10-dione;2-methylanthracene?
anthracene-9,10-dione;2-methylanthracene has a molecular weight of 400.48 g/mol, XLogP of 6.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dione;2-methylanthracene is sourced from PubChem (CID 159482173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).