About butan-1-ol;2-methylanthracene
butan-1-ol;2-methylanthracene (PubChem CID 157365265) has the molecular formula C19H22O
and a molecular weight of 266.38 g/mol. Its IUPAC name is butan-1-ol;2-methylanthracene.
Molecular Properties
| Compound Name | butan-1-ol;2-methylanthracene |
| PubChem CID | 157365265 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | butan-1-ol;2-methylanthracene |
| SMILES | CCCCO.Cc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C15H12.C4H10O/c1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11;1-2-3-4-5/h2-10H,1H3;5H,2-4H2,1H3 |
| InChIKey | BJCIMQFZTUJDFR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze butan-1-ol;2-methylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;2-methylanthracene?
The IUPAC name of butan-1-ol;2-methylanthracene (CID 157365265) is butan-1-ol;2-methylanthracene.
What is the SMILES notation for butan-1-ol;2-methylanthracene?
The canonical SMILES for butan-1-ol;2-methylanthracene is CCCCO.Cc1ccc2cc3ccccc3cc2c1.
What is the InChIKey of butan-1-ol;2-methylanthracene?
The InChIKey is BJCIMQFZTUJDFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C4H10O/c1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11;1-2-3-4-5/h2-10H,1H3;5H,2-4H2,1H3.
What are the key properties of butan-1-ol;2-methylanthracene?
butan-1-ol;2-methylanthracene has a molecular weight of 266.38 g/mol, XLogP of 5.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;2-methylanthracene is sourced from PubChem (CID 157365265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).