About naphthalene;octan-1-ol
naphthalene;octan-1-ol (PubChem CID 90016891) has the molecular formula C18H26O
and a molecular weight of 258.41 g/mol. Its IUPAC name is naphthalene;octan-1-ol.
Molecular Properties
| Compound Name | naphthalene;octan-1-ol |
| PubChem CID | 90016891 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | naphthalene;octan-1-ol |
| SMILES | CCCCCCCCO.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C8H18O/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-3-4-5-6-7-8-9/h1-8H;9H,2-8H2,1H3 |
| InChIKey | KFOYHHXWNRCGNU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze naphthalene;octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;octan-1-ol?
The IUPAC name of naphthalene;octan-1-ol (CID 90016891) is naphthalene;octan-1-ol.
What is the SMILES notation for naphthalene;octan-1-ol?
The canonical SMILES for naphthalene;octan-1-ol is CCCCCCCCO.c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;octan-1-ol?
The InChIKey is KFOYHHXWNRCGNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C8H18O/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-3-4-5-6-7-8-9/h1-8H;9H,2-8H2,1H3.
What are the key properties of naphthalene;octan-1-ol?
naphthalene;octan-1-ol has a molecular weight of 258.41 g/mol, XLogP of 5.18, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;octan-1-ol is sourced from PubChem (CID 90016891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).