C18H28 — CID 142191183
2,6-dimethylnaphthalene;propane (PubChem CID 142191183) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 2,6-dimethylnaphthalene;propane.
| Compound Name | 2,6-dimethylnaphthalene;propane |
|---|---|
| PubChem CID | 142191183 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2,6-dimethylnaphthalene;propane |
| SMILES | CCC.CCC.Cc1ccc2cc(C)ccc2c1 |
| InChI | InChI=1S/C12H12.2C3H8/c1-9-3-5-12-8-10(2)4-6-11(12)7-9;2*1-3-2/h3-8H,1-2H3;2*3H2,1-2H3 |
| InChIKey | CKAIRHSZBQIAAD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |