C16H22 — CID 143575841
ethane;3-ethyl-2,6-dimethylnaphthalene (PubChem CID 143575841) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is ethane;3-ethyl-2,6-dimethylnaphthalene.
| Compound Name | ethane;3-ethyl-2,6-dimethylnaphthalene |
|---|---|
| PubChem CID | 143575841 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | ethane;3-ethyl-2,6-dimethylnaphthalene |
| SMILES | CC.CCc1cc2cc(C)ccc2cc1C |
| InChI | InChI=1S/C14H16.C2H6/c1-4-12-9-14-7-10(2)5-6-13(14)8-11(12)3;1-2/h5-9H,4H2,1-3H3;1-2H3 |
| InChIKey | MPOCFEPKXDIMCF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |