About bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene
bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene (PubChem CID 70390972) has the molecular formula C15H16Br2O
and a molecular weight of 372.10 g/mol. Its IUPAC name is bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene.
Molecular Properties
| Compound Name | bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene |
| PubChem CID | 70390972 |
| Molecular Formula | C15H16Br2O |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene |
| SMILES | BrCc1ccccc1.COc1ccc(CBr)cc1 |
| InChI | InChI=1S/C8H9BrO.C7H7Br/c1-10-8-4-2-7(6-9)3-5-8;8-6-7-4-2-1-3-5-7/h2-5H,6H2,1H3;1-5H,6H2 |
| InChIKey | CHVYSUAIWGXBOF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene?
The IUPAC name of bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene (CID 70390972) is bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene.
What is the SMILES notation for bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene?
The canonical SMILES for bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene is BrCc1ccccc1.COc1ccc(CBr)cc1.
What is the InChIKey of bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene?
The InChIKey is CHVYSUAIWGXBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrO.C7H7Br/c1-10-8-4-2-7(6-9)3-5-8;8-6-7-4-2-1-3-5-7/h2-5H,6H2,1H3;1-5H,6H2.
What are the key properties of bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene?
bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene has a molecular weight of 372.10 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethylbenzene;1-(bromomethyl)-4-methoxybenzene is sourced from PubChem (CID 70390972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).