About 1-(bromomethyl)-4-ethylbenzene;ethylbenzene
1-(bromomethyl)-4-ethylbenzene;ethylbenzene (PubChem CID 157176611) has the molecular formula C17H21Br
and a molecular weight of 305.26 g/mol. Its IUPAC name is 1-(bromomethyl)-4-ethylbenzene;ethylbenzene.
Molecular Properties
| Compound Name | 1-(bromomethyl)-4-ethylbenzene;ethylbenzene |
| PubChem CID | 157176611 |
| Molecular Formula | C17H21Br |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-(bromomethyl)-4-ethylbenzene;ethylbenzene |
| SMILES | CCc1ccc(CBr)cc1.CCc1ccccc1 |
| InChI | InChI=1S/C9H11Br.C8H10/c1-2-8-3-5-9(7-10)6-4-8;1-2-8-6-4-3-5-7-8/h3-6H,2,7H2,1H3;3-7H,2H2,1H3 |
| InChIKey | AOBUOUIRTXXGLT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-4-ethylbenzene;ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-4-ethylbenzene;ethylbenzene?
The IUPAC name of 1-(bromomethyl)-4-ethylbenzene;ethylbenzene (CID 157176611) is 1-(bromomethyl)-4-ethylbenzene;ethylbenzene.
What is the SMILES notation for 1-(bromomethyl)-4-ethylbenzene;ethylbenzene?
The canonical SMILES for 1-(bromomethyl)-4-ethylbenzene;ethylbenzene is CCc1ccc(CBr)cc1.CCc1ccccc1.
What is the InChIKey of 1-(bromomethyl)-4-ethylbenzene;ethylbenzene?
The InChIKey is AOBUOUIRTXXGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Br.C8H10/c1-2-8-3-5-9(7-10)6-4-8;1-2-8-6-4-3-5-7-8/h3-6H,2,7H2,1H3;3-7H,2H2,1H3.
What are the key properties of 1-(bromomethyl)-4-ethylbenzene;ethylbenzene?
1-(bromomethyl)-4-ethylbenzene;ethylbenzene has a molecular weight of 305.26 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-4-ethylbenzene;ethylbenzene is sourced from PubChem (CID 157176611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).