C51H54O9 — CID 11764294
1-[[(1S,2S,3S,4R,5S,6R)-2,5-bis[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)cyclohexyl]oxymethyl]-4-methoxybenzene (PubChem CID 11764294) has the molecular formula C51H54O9 and a molecular weight of 810.98 g/mol. Its IUPAC name is 1-[[(1S,2S,3S,4R,5S,6R)-2,5-bis[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)cyclohexyl]oxymethyl]-4-methoxybenzene.
| Compound Name | 1-[[(1S,2S,3S,4R,5S,6R)-2,5-bis[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)cyclohexyl]oxymethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 11764294 |
| Molecular Formula | C51H54O9 |
| Molecular Weight | 810.98 g/mol |
| Exact Mass | 810.38 |
| IUPAC Name | 1-[[(1S,2S,3S,4R,5S,6R)-2,5-bis[(4-methoxyphenyl)methoxy]-3,4,6-tris(phenylmethoxy)cyclohexyl]oxymethyl]-4-methoxybenzene |
| SMILES | COc1ccc(CO[C@H]2[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccc(OC)cc3)[C@@H](OCc3ccc(OC)cc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C51H54O9/c1-52-43-25-19-40(20-26-43)34-58-49-46(55-31-37-13-7-4-8-14-37)47(56-32-38-15-9-5-10-16-38)50(59-35-41-21-27-44(53-2)28-22-41)51(48(49)57-33-39-17-11-6-12-18-39)60-36-42-23-29-45(54-3)30-24-42/h4-30,46-51H,31-36H2,1-3H3/t46-,47+,48-,49+,50+,51+/m1/s1 |
| InChIKey | KBEFPMVEBLQQSN-YJZATJJDSA-N |
| XLogP | 9.54 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.98 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |