C35H38O7 — CID 11071884
(1R,3S,4R,6R)-5-[(4-methoxyphenyl)methoxy]-2,4,6-tris(phenylmethoxy)cyclohexane-1,3-diol (PubChem CID 11071884) has the molecular formula C35H38O7 and a molecular weight of 570.68 g/mol. Its IUPAC name is (1R,3S,4R,6R)-5-[(4-methoxyphenyl)methoxy]-2,4,6-tris(phenylmethoxy)cyclohexane-1,3-diol.
| Compound Name | (1R,3S,4R,6R)-5-[(4-methoxyphenyl)methoxy]-2,4,6-tris(phenylmethoxy)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11071884 |
| Molecular Formula | C35H38O7 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | (1R,3S,4R,6R)-5-[(4-methoxyphenyl)methoxy]-2,4,6-tris(phenylmethoxy)cyclohexane-1,3-diol |
| SMILES | COc1ccc(COC2[C@H](OCc3ccccc3)C(O)C(OCc3ccccc3)[C@H](O)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H38O7/c1-38-29-19-17-28(18-20-29)24-42-35-33(40-22-26-13-7-3-8-14-26)30(36)32(39-21-25-11-5-2-6-12-25)31(37)34(35)41-23-27-15-9-4-10-16-27/h2-20,30-37H,21-24H2,1H3/t30-,31?,32?,33+,34+,35?/m0/s1 |
| InChIKey | GXBVLQSRATUSHE-MMVQOOLJSA-N |
| XLogP | 5.07 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |