C36H40O7 — CID 11734590
(1R,2R,3S,4R,5R,6S)-2-(hydroxymethyl)-3-[(4-methoxyphenyl)methoxy]-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol (PubChem CID 11734590) has the molecular formula C36H40O7 and a molecular weight of 584.71 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R,6S)-2-(hydroxymethyl)-3-[(4-methoxyphenyl)methoxy]-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2R,3S,4R,5R,6S)-2-(hydroxymethyl)-3-[(4-methoxyphenyl)methoxy]-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11734590 |
| Molecular Formula | C36H40O7 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | (1R,2R,3S,4R,5R,6S)-2-(hydroxymethyl)-3-[(4-methoxyphenyl)methoxy]-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol |
| SMILES | COc1ccc(CO[C@H]2[C@H](CO)[C@@H](O)C(OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H40O7/c1-39-30-19-17-29(18-20-30)25-40-33-31(21-37)32(38)34(41-22-26-11-5-2-6-12-26)36(43-24-28-15-9-4-10-16-28)35(33)42-23-27-13-7-3-8-14-27/h2-20,31-38H,21-25H2,1H3/t31-,32-,33+,34?,35-,36-/m1/s1 |
| InChIKey | URVBMXHHDPJSGP-CCWNCRDMSA-N |
| XLogP | 5.32 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |