C23H32O7 — CID 10502229
(1S,2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-4,5,6-tris(prop-2-enoxy)cyclohexane-1,2-diol (PubChem CID 10502229) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is (1S,2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-4,5,6-tris(prop-2-enoxy)cyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-4,5,6-tris(prop-2-enoxy)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 10502229 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (1S,2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-4,5,6-tris(prop-2-enoxy)cyclohexane-1,2-diol |
| SMILES | C=CCO[C@@H]1[C@@H](OCC=C)[C@H](OCC=C)[C@@H](O)[C@@H](O)[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H32O7/c1-5-12-27-20-18(24)19(25)21(23(29-14-7-3)22(20)28-13-6-2)30-15-16-8-10-17(26-4)11-9-16/h5-11,18-25H,1-3,12-15H2,4H3/t18-,19+,20+,21+,22-,23-/m0/s1 |
| InChIKey | HJVQHEMQEWNMAU-RSFSFSNISA-N |
| XLogP | 2.03 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|