C26H32O6 — CID 7099090
(1S,2R,3R,4S,5S,6S)-4,5-bis(phenylmethoxy)-3,6-bis(prop-2-enoxy)cyclohexane-1,2-diol (PubChem CID 7099090) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is (1S,2R,3R,4S,5S,6S)-4,5-bis(phenylmethoxy)-3,6-bis(prop-2-enoxy)cyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,5S,6S)-4,5-bis(phenylmethoxy)-3,6-bis(prop-2-enoxy)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 7099090 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (1S,2R,3R,4S,5S,6S)-4,5-bis(phenylmethoxy)-3,6-bis(prop-2-enoxy)cyclohexane-1,2-diol |
| SMILES | C=CCO[C@@H]1[C@H](O)[C@H](O)[C@H](OCC=C)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H32O6/c1-3-15-29-23-21(27)22(28)24(30-16-4-2)26(32-18-20-13-9-6-10-14-20)25(23)31-17-19-11-7-5-8-12-19/h3-14,21-28H,1-2,15-18H2/t21-,22+,23-,24+,25-,26-/m0/s1 |
| InChIKey | WZERQFNBSBWGLE-HQJTZPOCSA-N |
| XLogP | 3.04 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|