C31H40O8 — CID 10602538
(3aS,4S,5S,6S,7S,7aR)-5,6-bis[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4,7-bis(prop-2-enoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole (PubChem CID 10602538) has the molecular formula C31H40O8 and a molecular weight of 540.65 g/mol. Its IUPAC name is (3aS,4S,5S,6S,7S,7aR)-5,6-bis[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4,7-bis(prop-2-enoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole.
| Compound Name | (3aS,4S,5S,6S,7S,7aR)-5,6-bis[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4,7-bis(prop-2-enoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 10602538 |
| Molecular Formula | C31H40O8 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | (3aS,4S,5S,6S,7S,7aR)-5,6-bis[(4-methoxyphenyl)methoxy]-2,2-dimethyl-4,7-bis(prop-2-enoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole |
| SMILES | C=CCO[C@H]1[C@H](OCc2ccc(OC)cc2)[C@@H](OCc2ccc(OC)cc2)[C@H](OCC=C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C31H40O8/c1-7-17-34-27-25(36-19-21-9-13-23(32-5)14-10-21)26(37-20-22-11-15-24(33-6)16-12-22)28(35-18-8-2)30-29(27)38-31(3,4)39-30/h7-16,25-30H,1-2,17-20H2,3-6H3/t25-,26-,27+,28+,29-,30+/m1/s1 |
| InChIKey | JXACWCQSVNAKMM-FBLDLFPLSA-N |
| XLogP | 4.85 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|