C20H28O7 — CID 11646597
(1R,3S,7R,9R)-8-[(4-methoxyphenyl)methoxy]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol (PubChem CID 11646597) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (1R,3S,7R,9R)-8-[(4-methoxyphenyl)methoxy]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol.
| Compound Name | (1R,3S,7R,9R)-8-[(4-methoxyphenyl)methoxy]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol |
|---|---|
| PubChem CID | 11646597 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (1R,3S,7R,9R)-8-[(4-methoxyphenyl)methoxy]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol |
| SMILES | COc1ccc(COC2[C@H]3OC(C)(C)O[C@@H]3C(O)[C@@H]3OC(C)(C)O[C@H]23)cc1 |
| InChI | InChI=1S/C20H28O7/c1-19(2)24-14-13(21)15-18(27-20(3,4)25-15)16(17(14)26-19)23-10-11-6-8-12(22-5)9-7-11/h6-9,13-18,21H,10H2,1-5H3/t13?,14-,15+,16?,17-,18-/m0/s1 |
| InChIKey | DUMKSQYVRLYGOP-DPTOJEBYSA-N |
| XLogP | 2.00 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |