C18H24O6 — CID 132969570
(3aS,8S,8aR)-5-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-6,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxole-7,8-diol (PubChem CID 132969570) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is (3aS,8S,8aR)-5-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-6,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxole-7,8-diol.
| Compound Name | (3aS,8S,8aR)-5-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-6,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxole-7,8-diol |
|---|---|
| PubChem CID | 132969570 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (3aS,8S,8aR)-5-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-6,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxole-7,8-diol |
| SMILES | COc1ccc(COC2=C[C@@H]3OC(C)(C)O[C@@H]3[C@@H](O)C(O)C2)cc1 |
| InChI | InChI=1S/C18H24O6/c1-18(2)23-15-9-13(8-14(19)16(20)17(15)24-18)22-10-11-4-6-12(21-3)7-5-11/h4-7,9,14-17,19-20H,8,10H2,1-3H3/t14?,15-,16-,17-/m0/s1 |
| InChIKey | FSAILBGBOGARDR-OZCCTXIFSA-N |
| XLogP | 1.74 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |