C23H28O5S — CID 59132158
(3aS,4R,5R,8R,8aS)-2,2-dimethyl-5-[(4-phenylmethoxyphenyl)methyl]-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol (PubChem CID 59132158) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is (3aS,4R,5R,8R,8aS)-2,2-dimethyl-5-[(4-phenylmethoxyphenyl)methyl]-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol.
| Compound Name | (3aS,4R,5R,8R,8aS)-2,2-dimethyl-5-[(4-phenylmethoxyphenyl)methyl]-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol |
|---|---|
| PubChem CID | 59132158 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (3aS,4R,5R,8R,8aS)-2,2-dimethyl-5-[(4-phenylmethoxyphenyl)methyl]-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](O)[C@@H](Cc1ccc(OCc3ccccc3)cc1)SC[C@@H]2O |
| InChI | InChI=1S/C23H28O5S/c1-23(2)27-21-18(24)14-29-19(20(25)22(21)28-23)12-15-8-10-17(11-9-15)26-13-16-6-4-3-5-7-16/h3-11,18-22,24-25H,12-14H2,1-2H3/t18-,19+,20-,21-,22-/m0/s1 |
| InChIKey | ASLACJUCYQAFTQ-WIYBCGNWSA-N |
| XLogP | 3.17 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |