C29H32N2O4 — CID 59131827
(3aS,4R,8R,8aS)-8-benzyl-2,2-dimethyl-4-[(4-phenylmethoxyphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one (PubChem CID 59131827) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is (3aS,4R,8R,8aS)-8-benzyl-2,2-dimethyl-4-[(4-phenylmethoxyphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one.
| Compound Name | (3aS,4R,8R,8aS)-8-benzyl-2,2-dimethyl-4-[(4-phenylmethoxyphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
|---|---|
| PubChem CID | 59131827 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (3aS,4R,8R,8aS)-8-benzyl-2,2-dimethyl-4-[(4-phenylmethoxyphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](Cc1ccc(OCc3ccccc3)cc1)NC(=O)N[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C29H32N2O4/c1-29(2)34-26-24(17-20-9-5-3-6-10-20)30-28(32)31-25(27(26)35-29)18-21-13-15-23(16-14-21)33-19-22-11-7-4-8-12-22/h3-16,24-27H,17-19H2,1-2H3,(H2,30,31,32)/t24-,25-,26+,27+/m1/s1 |
| InChIKey | DQHLFPFWGAVQSR-XDZXDJIYSA-N |
| XLogP | 4.62 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |