C21H24N2O3 — CID 155533576
(3R,6S)-3-[(4-phenylmethoxyphenyl)methyl]-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 155533576) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (3R,6S)-3-[(4-phenylmethoxyphenyl)methyl]-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | (3R,6S)-3-[(4-phenylmethoxyphenyl)methyl]-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 155533576 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3R,6S)-3-[(4-phenylmethoxyphenyl)methyl]-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](Cc2ccc(OCc3ccccc3)cc2)NC1=O |
| InChI | InChI=1S/C21H24N2O3/c1-14(2)19-21(25)22-18(20(24)23-19)12-15-8-10-17(11-9-15)26-13-16-6-4-3-5-7-16/h3-11,14,18-19H,12-13H2,1-2H3,(H,22,25)(H,23,24)/t18-,19+/m1/s1 |
| InChIKey | KOTFNQQYSJQUKY-MOPGFXCFSA-N |
| XLogP | 2.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |