C24H23N3O3 — CID 58981828
3-benzyl-6-[(5-phenylmethoxy-2-pyridinyl)methyl]piperazine-2,5-dione (PubChem CID 58981828) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-benzyl-6-[(5-phenylmethoxy-2-pyridinyl)methyl]piperazine-2,5-dione.
| Compound Name | 3-benzyl-6-[(5-phenylmethoxy-2-pyridinyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 58981828 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-benzyl-6-[(5-phenylmethoxy-2-pyridinyl)methyl]piperazine-2,5-dione |
| SMILES | O=C1NC(Cc2ccc(OCc3ccccc3)cn2)C(=O)NC1Cc1ccccc1 |
| InChI | InChI=1S/C24H23N3O3/c28-23-21(13-17-7-3-1-4-8-17)26-24(29)22(27-23)14-19-11-12-20(15-25-19)30-16-18-9-5-2-6-10-18/h1-12,15,21-22H,13-14,16H2,(H,26,29)(H,27,28) |
| InChIKey | JVDGYWNRNXWDTH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |