C28H42N6O7 — CID 101086473
(3S,6S,9S,12R,15S,18S)-3-[(4-hydroxyphenyl)methyl]-6,12,18-trimethyl-9,15-di(propan-2-yl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 101086473) has the molecular formula C28H42N6O7 and a molecular weight of 574.68 g/mol. Its IUPAC name is (3S,6S,9S,12R,15S,18S)-3-[(4-hydroxyphenyl)methyl]-6,12,18-trimethyl-9,15-di(propan-2-yl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | (3S,6S,9S,12R,15S,18S)-3-[(4-hydroxyphenyl)methyl]-6,12,18-trimethyl-9,15-di(propan-2-yl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 101086473 |
| Molecular Formula | C28H42N6O7 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | (3S,6S,9S,12R,15S,18S)-3-[(4-hydroxyphenyl)methyl]-6,12,18-trimethyl-9,15-di(propan-2-yl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](C)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](C)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C28H42N6O7/c1-13(2)21-27(40)30-15(5)23(36)32-20(12-18-8-10-19(35)11-9-18)26(39)29-16(6)24(37)33-22(14(3)4)28(41)31-17(7)25(38)34-21/h8-11,13-17,20-22,35H,12H2,1-7H3,(H,29,39)(H,30,40)(H,31,41)(H,32,36)(H,33,37)(H,34,38)/t15-,16-,17+,20-,21-,22-/m0/s1 |
| InChIKey | PRCYIUAZDCUPMY-UQHDCFDMSA-N |
| XLogP | -0.77 |
| TPSA | 194.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |