C18H20N2O2 — CID 22088981
4,6-dibenzyl-5-hydroxy-1,3-diazinan-2-one (PubChem CID 22088981) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4,6-dibenzyl-5-hydroxy-1,3-diazinan-2-one.
| Compound Name | 4,6-dibenzyl-5-hydroxy-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 22088981 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4,6-dibenzyl-5-hydroxy-1,3-diazinan-2-one |
| SMILES | O=C1NC(Cc2ccccc2)C(O)C(Cc2ccccc2)N1 |
| InChI | InChI=1S/C18H20N2O2/c21-17-15(11-13-7-3-1-4-8-13)19-18(22)20-16(17)12-14-9-5-2-6-10-14/h1-10,15-17,21H,11-12H2,(H2,19,20,22) |
| InChIKey | CMNDRGWYZFNWCC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |