C20H24N2O2 — CID 101209097
(4R,6R)-5-hydroxy-4,6-bis(2-phenylethyl)-1,3-diazinan-2-one (PubChem CID 101209097) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (4R,6R)-5-hydroxy-4,6-bis(2-phenylethyl)-1,3-diazinan-2-one.
| Compound Name | (4R,6R)-5-hydroxy-4,6-bis(2-phenylethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 101209097 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (4R,6R)-5-hydroxy-4,6-bis(2-phenylethyl)-1,3-diazinan-2-one |
| SMILES | O=C1N[C@H](CCc2ccccc2)C(O)[C@@H](CCc2ccccc2)N1 |
| InChI | InChI=1S/C20H24N2O2/c23-19-17(13-11-15-7-3-1-4-8-15)21-20(24)22-18(19)14-12-16-9-5-2-6-10-16/h1-10,17-19,23H,11-14H2,(H2,21,22,24)/t17-,18-/m1/s1 |
| InChIKey | QYHOJXPFYLNEMB-QZTJIDSGSA-N |
| XLogP | 2.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |