(4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate

C21H24N2O4 — CID 22089000

IUPAC(4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate
SMILESCC(=O)OC1C(Cc2ccccc2)NC(=O)NC(Cc2ccccc2)C1O
InChIInChI=1S/C21H24N2O4/c1-14(24)27-20-18(13-16-10-6-3-7-11-16)23-21(26)22-17(19(20)25)12-15-8-4-2-5-9-15/h2-11,17-20,25H,12-13H2,1H3,(H2,22,23,26)
InChIKeyMSLOUSLQYGANBD-UHFFFAOYSA-N
MW368.43 g/mol
LogP1.81
Rot. Bonds5

About (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate

(4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate (PubChem CID 22089000) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate.

Molecular Properties

Compound Name(4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate
PubChem CID22089000
Molecular FormulaC21H24N2O4
Molecular Weight368.43 g/mol
Exact Mass368.17
IUPAC Name(4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate
SMILESCC(=O)OC1C(Cc2ccccc2)NC(=O)NC(Cc2ccccc2)C1O
InChIInChI=1S/C21H24N2O4/c1-14(24)27-20-18(13-16-10-6-3-7-11-16)23-21(26)22-17(19(20)25)12-15-8-4-2-5-9-15/h2-11,17-20,25H,12-13H2,1H3,(H2,22,23,26)
InChIKeyMSLOUSLQYGANBD-UHFFFAOYSA-N
XLogP1.81
TPSA87.66 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500368.43
LogP ≤ 51.81
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate?
The IUPAC name of (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate (CID 22089000) is (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate.
What is the SMILES notation for (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate?
The canonical SMILES for (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate is CC(=O)OC1C(Cc2ccccc2)NC(=O)NC(Cc2ccccc2)C1O.
What is the InChIKey of (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate?
The InChIKey is MSLOUSLQYGANBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O4/c1-14(24)27-20-18(13-16-10-6-3-7-11-16)23-21(26)22-17(19(20)25)12-15-8-4-2-5-9-15/h2-11,17-20,25H,12-13H2,1H3,(H2,22,23,26).
What are the key properties of (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate?
(4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate has a molecular weight of 368.43 g/mol, XLogP of 1.81, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate is sourced from PubChem (CID 22089000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).