C21H24N2O4 — CID 22089000
(4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate (PubChem CID 22089000) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate.
| Compound Name | (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate |
|---|---|
| PubChem CID | 22089000 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (4,7-dibenzyl-6-hydroxy-2-oxo-1,3-diazepan-5-yl) acetate |
| SMILES | CC(=O)OC1C(Cc2ccccc2)NC(=O)NC(Cc2ccccc2)C1O |
| InChI | InChI=1S/C21H24N2O4/c1-14(24)27-20-18(13-16-10-6-3-7-11-16)23-21(26)22-17(19(20)25)12-15-8-4-2-5-9-15/h2-11,17-20,25H,12-13H2,1H3,(H2,22,23,26) |
| InChIKey | MSLOUSLQYGANBD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |