C21H24N2O4 — CID 22857227
(1S,7R,8S,12S)-8,12-dibenzyl-2,4,6-trioxa-9,11-diazabicyclo[5.5.0]dodecan-10-one (PubChem CID 22857227) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (1S,7R,8S,12S)-8,12-dibenzyl-2,4,6-trioxa-9,11-diazabicyclo[5.5.0]dodecan-10-one.
| Compound Name | (1S,7R,8S,12S)-8,12-dibenzyl-2,4,6-trioxa-9,11-diazabicyclo[5.5.0]dodecan-10-one |
|---|---|
| PubChem CID | 22857227 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (1S,7R,8S,12S)-8,12-dibenzyl-2,4,6-trioxa-9,11-diazabicyclo[5.5.0]dodecan-10-one |
| SMILES | O=C1N[C@@H](Cc2ccccc2)[C@@H]2OCOCO[C@@H]2[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C21H24N2O4/c24-21-22-17(11-15-7-3-1-4-8-15)19-20(27-14-25-13-26-19)18(23-21)12-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2,(H2,22,23,24)/t17-,18-,19-,20+/m0/s1 |
| InChIKey | PXSTYGRRXAYPEZ-LWYYNNOASA-N |
| XLogP | 2.24 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |