C26H34N2O3 — CID 100984890
(3aS,4R,8R,8aS)-4,8-bis[(4-propan-2-ylphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one (PubChem CID 100984890) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is (3aS,4R,8R,8aS)-4,8-bis[(4-propan-2-ylphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one.
| Compound Name | (3aS,4R,8R,8aS)-4,8-bis[(4-propan-2-ylphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
|---|---|
| PubChem CID | 100984890 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (3aS,4R,8R,8aS)-4,8-bis[(4-propan-2-ylphenyl)methyl]-3a,4,5,7,8,8a-hexahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
| SMILES | CC(C)c1ccc(C[C@H]2NC(=O)N[C@H](Cc3ccc(C(C)C)cc3)[C@@H]3OCO[C@H]32)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-16(2)20-9-5-18(6-10-20)13-22-24-25(31-15-30-24)23(28-26(29)27-22)14-19-7-11-21(12-8-19)17(3)4/h5-12,16-17,22-25H,13-15H2,1-4H3,(H2,27,28,29)/t22-,23-,24+,25+/m1/s1 |
| InChIKey | XFPKRZDNKNHJNA-NGSHPTGOSA-N |
| XLogP | 4.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |