C28H36N4O7 — CID 101211209
trans-(12S,17S)-12,17-dibenzyl-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,14,15,18-tetrone (PubChem CID 101211209) has the molecular formula C28H36N4O7 and a molecular weight of 540.62 g/mol. Its IUPAC name is trans-(12S,17S)-12,17-dibenzyl-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,14,15,18-tetrone.
| Compound Name | trans-(12S,17S)-12,17-dibenzyl-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,14,15,18-tetrone |
|---|---|
| PubChem CID | 101211209 |
| Molecular Formula | C28H36N4O7 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | trans-(12S,17S)-12,17-dibenzyl-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,14,15,18-tetrone |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)NCCOCCOCCOCCNC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C28H36N4O7/c33-25-23(19-21-7-3-1-4-8-21)31-27(35)28(36)32-24(20-22-9-5-2-6-10-22)26(34)30-12-14-38-16-18-39-17-15-37-13-11-29-25/h1-10,23-24H,11-20H2,(H,29,33)(H,30,34)(H,31,35)(H,32,36)/t23-,24-/m0/s1 |
| InChIKey | AUFCWANGUSIVQI-ZEQRLZLVSA-N |
| XLogP | -0.26 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|