C11H12N2O2 — CID 928691
(3R)-3-benzylpiperazine-2,5-dione (PubChem CID 928691) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is (3R)-3-benzylpiperazine-2,5-dione.
| Compound Name | (3R)-3-benzylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 928691 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (3R)-3-benzylpiperazine-2,5-dione |
| SMILES | O=C1CNC(=O)[C@@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C11H12N2O2/c14-10-7-12-11(15)9(13-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,15)(H,13,14)/t9-/m1/s1 |
| InChIKey | UZOJHXFWJFSFAI-SECBINFHSA-N |
| XLogP | -0.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |