C11H11IN2O2 — CID 131856025
(3S)-3-[(4-iodophenyl)methyl]piperazine-2,5-dione (PubChem CID 131856025) has the molecular formula C11H11IN2O2 and a molecular weight of 330.13 g/mol. Its IUPAC name is (3S)-3-[(4-iodophenyl)methyl]piperazine-2,5-dione.
| Compound Name | (3S)-3-[(4-iodophenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 131856025 |
| Molecular Formula | C11H11IN2O2 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | (3S)-3-[(4-iodophenyl)methyl]piperazine-2,5-dione |
| SMILES | O=C1CNC(=O)[C@H](Cc2ccc(I)cc2)N1 |
| InChI | InChI=1S/C11H11IN2O2/c12-8-3-1-7(2-4-8)5-9-11(16)13-6-10(15)14-9/h1-4,9H,5-6H2,(H,13,16)(H,14,15)/t9-/m0/s1 |
| InChIKey | ODQBILVDSQSHEF-VIFPVBQESA-N |
| XLogP | 0.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|