C10H16N4O4S2 — CID 154446648
trans-(3R,6R)-3,6-bis(sulfanylmethyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (PubChem CID 154446648) has the molecular formula C10H16N4O4S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is trans-(3R,6R)-3,6-bis(sulfanylmethyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | trans-(3R,6R)-3,6-bis(sulfanylmethyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 154446648 |
| Molecular Formula | C10H16N4O4S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | trans-(3R,6R)-3,6-bis(sulfanylmethyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | O=C1CNC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)CN1 |
| InChI | InChI=1S/C10H16N4O4S2/c15-7-1-12-9(17)5(3-19)14-10(18)6(4-20)13-8(16)2-11-7/h5-6,19-20H,1-4H2,(H,11,15)(H,12,17)(H,13,16)(H,14,18)/t5-,6-/m0/s1 |
| InChIKey | AEKYPAGTUCYZSA-WDSKDSINSA-N |
| XLogP | -2.94 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|