C6H10N2O3 — CID 16639267
(3S)-3-(2-hydroxyethyl)piperazine-2,5-dione (PubChem CID 16639267) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is (3S)-3-(2-hydroxyethyl)piperazine-2,5-dione.
| Compound Name | (3S)-3-(2-hydroxyethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 16639267 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (3S)-3-(2-hydroxyethyl)piperazine-2,5-dione |
| SMILES | O=C1CNC(=O)[C@H](CCO)N1 |
| InChI | InChI=1S/C6H10N2O3/c9-2-1-4-6(11)7-3-5(10)8-4/h4,9H,1-3H2,(H,7,11)(H,8,10)/t4-/m0/s1 |
| InChIKey | YUMNGCOHGVQKNN-BYPYZUCNSA-N |
| XLogP | -2.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |