C14H18N2O2 — CID 69365417
(3S)-3-(4-phenylbutyl)piperazine-2,5-dione (PubChem CID 69365417) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3S)-3-(4-phenylbutyl)piperazine-2,5-dione.
| Compound Name | (3S)-3-(4-phenylbutyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 69365417 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (3S)-3-(4-phenylbutyl)piperazine-2,5-dione |
| SMILES | O=C1CNC(=O)[C@H](CCCCc2ccccc2)N1 |
| InChI | InChI=1S/C14H18N2O2/c17-13-10-15-14(18)12(16-13)9-5-4-8-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H,15,18)(H,16,17)/t12-/m0/s1 |
| InChIKey | ZHWKVAXPRSDPRN-LBPRGKRZSA-N |
| XLogP | 1.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|