C23H32N8O7 — CID 50907044
(5S,8R,14S)-8-benzyl-5-[3-(diaminomethylideneamino)propyl]-3,6,9,12,16-pentaoxo-1,4,7,10,13-pentazacyclohexadecane-14-carboxylic acid (PubChem CID 50907044) has the molecular formula C23H32N8O7 and a molecular weight of 532.56 g/mol. Its IUPAC name is (5S,8R,14S)-8-benzyl-5-[3-(diaminomethylideneamino)propyl]-3,6,9,12,16-pentaoxo-1,4,7,10,13-pentazacyclohexadecane-14-carboxylic acid.
| Compound Name | (5S,8R,14S)-8-benzyl-5-[3-(diaminomethylideneamino)propyl]-3,6,9,12,16-pentaoxo-1,4,7,10,13-pentazacyclohexadecane-14-carboxylic acid |
|---|---|
| PubChem CID | 50907044 |
| Molecular Formula | C23H32N8O7 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | (5S,8R,14S)-8-benzyl-5-[3-(diaminomethylideneamino)propyl]-3,6,9,12,16-pentaoxo-1,4,7,10,13-pentazacyclohexadecane-14-carboxylic acid |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)CNC(=O)C[C@@H](C(=O)O)NC(=O)CNC(=O)[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C23H32N8O7/c24-23(25)26-8-4-7-14-21(36)31-15(9-13-5-2-1-3-6-13)20(35)28-12-19(34)30-16(22(37)38)10-17(32)27-11-18(33)29-14/h1-3,5-6,14-16H,4,7-12H2,(H,27,32)(H,28,35)(H,29,33)(H,30,34)(H,31,36)(H,37,38)(H4,24,25,26)/t14-,15+,16-/m0/s1 |
| InChIKey | SACDMAPTXUTMGV-XHSDSOJGSA-N |
| XLogP | -3.54 |
| TPSA | 247.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|