C19H31N9O8S — CID 71767680
(5S,14R,17S)-5-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,19-hexaoxo-14-(sulfanylmethyl)-1,4,7,10,13,16-hexazacyclononadecane-17-carboxylic acid (PubChem CID 71767680) has the molecular formula C19H31N9O8S and a molecular weight of 545.58 g/mol. Its IUPAC name is (5S,14R,17S)-5-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,19-hexaoxo-14-(sulfanylmethyl)-1,4,7,10,13,16-hexazacyclononadecane-17-carboxylic acid.
| Compound Name | (5S,14R,17S)-5-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,19-hexaoxo-14-(sulfanylmethyl)-1,4,7,10,13,16-hexazacyclononadecane-17-carboxylic acid |
|---|---|
| PubChem CID | 71767680 |
| Molecular Formula | C19H31N9O8S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (5S,14R,17S)-5-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,19-hexaoxo-14-(sulfanylmethyl)-1,4,7,10,13,16-hexazacyclononadecane-17-carboxylic acid |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)CNC(=O)C[C@@H](C(=O)O)NC(=O)[C@H](CS)NC(=O)CNC(=O)CNC1=O |
| InChI | InChI=1S/C19H31N9O8S/c20-19(21)22-3-1-2-9-16(33)25-5-13(30)24-7-15(32)27-11(8-37)17(34)28-10(18(35)36)4-12(29)23-6-14(31)26-9/h9-11,37H,1-8H2,(H,23,29)(H,24,30)(H,25,33)(H,26,31)(H,27,32)(H,28,34)(H,35,36)(H4,20,21,22)/t9-,10-,11-/m0/s1 |
| InChIKey | VRWLDFOWEALYGK-DCAQKATOSA-N |
| XLogP | -5.74 |
| TPSA | 276.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | -5.74 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|